C22H24N4O2S — CID 56505681
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide (PubChem CID 56505681) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 56505681 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(2-oxopiperidin-1-yl)-2-phenylacetamide |
| SMILES | O=C(NCCNc1nc2ccccc2s1)C(c1ccccc1)N1CCCCC1=O |
| InChI | InChI=1S/C22H24N4O2S/c27-19-12-6-7-15-26(19)20(16-8-2-1-3-9-16)21(28)23-13-14-24-22-25-17-10-4-5-11-18(17)29-22/h1-5,8-11,20H,6-7,12-15H2,(H,23,28)(H,24,25) |
| InChIKey | QVNFLBXZYZOIIQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|