C18H26N2O7S2 — CID 56519153
N-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-6-oxohexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 56519153) has the molecular formula C18H26N2O7S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-6-oxohexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-6-oxohexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 56519153 |
| Molecular Formula | C18H26N2O7S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[6-(1,1-dioxo-1,4-thiazinan-4-yl)-6-oxohexyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H26N2O7S2/c21-18(20-8-12-28(22,23)13-9-20)4-2-1-3-7-19-29(24,25)15-5-6-16-17(14-15)27-11-10-26-16/h5-6,14,19H,1-4,7-13H2 |
| InChIKey | FRFXDPWLUYHBTC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|