C21H31F2N3O2 — CID 56553116
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-N',N'-dipropylpentanediamide (PubChem CID 56553116) has the molecular formula C21H31F2N3O2 and a molecular weight of 395.49 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-N',N'-dipropylpentanediamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 56553116 |
| Molecular Formula | C21H31F2N3O2 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)Nc1cc(F)c(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H31F2N3O2/c1-3-10-25(11-4-2)20(28)9-7-8-19(27)24-16-14-17(22)21(18(23)15-16)26-12-5-6-13-26/h14-15H,3-13H2,1-2H3,(H,24,27) |
| InChIKey | WFXXZHZEIQTJHJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|