C18H15ClN2O6S — CID 56586996
methyl 3-(2-chlorophenyl)-3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]propanoate (PubChem CID 56586996) has the molecular formula C18H15ClN2O6S and a molecular weight of 422.85 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 56586996 |
| Molecular Formula | C18H15ClN2O6S |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[(1,3-dioxoisoindol-5-yl)sulfonylamino]propanoate |
| SMILES | COC(=O)CC(NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H15ClN2O6S/c1-27-16(22)9-15(12-4-2-3-5-14(12)19)21-28(25,26)10-6-7-11-13(8-10)18(24)20-17(11)23/h2-8,15,21H,9H2,1H3,(H,20,23,24) |
| InChIKey | VZHQWJGRAGNCGX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|