C30H39F4NO3S — CID 56592150
6-(4-fluorophenyl)-5-[6-[methyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 56592150) has the molecular formula C30H39F4NO3S and a molecular weight of 569.71 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-[6-[methyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(4-fluorophenyl)-5-[6-[methyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 56592150 |
| Molecular Formula | C30H39F4NO3S |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 6-(4-fluorophenyl)-5-[6-[methyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CN(CCCCCCC1=C(c2ccc(F)cc2)CCCc2cc(O)ccc21)CCCS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C30H39F4NO3S/c1-35(19-7-20-39(37,38)21-17-30(32,33)34)18-5-3-2-4-9-29-27(23-11-13-25(31)14-12-23)10-6-8-24-22-26(36)15-16-28(24)29/h11-16,22,36H,2-10,17-21H2,1H3 |
| InChIKey | WPWVLAFEJAFQAU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|