C34H45F4NO3S — CID 123213300
6-(4-fluorophenyl)-5-[5-[2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidin-1-yl]pentyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 123213300) has the molecular formula C34H45F4NO3S and a molecular weight of 623.80 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-[5-[2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidin-1-yl]pentyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(4-fluorophenyl)-5-[5-[2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidin-1-yl]pentyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 123213300 |
| Molecular Formula | C34H45F4NO3S |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 6-(4-fluorophenyl)-5-[5-[2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidin-1-yl]pentyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | O=S(=O)(CCCCC(F)(F)F)CCCC1CCCN1CCCCCC1=C(c2ccc(F)cc2)CCCc2cc(O)ccc21 |
| InChI | InChI=1S/C34H45F4NO3S/c35-28-16-14-26(15-17-28)31-13-6-9-27-25-30(40)18-19-32(27)33(31)12-2-1-4-21-39-22-7-10-29(39)11-8-24-43(41,42)23-5-3-20-34(36,37)38/h14-19,25,29,40H,1-13,20-24H2 |
| InChIKey | MKAYLFSLFBSRMZ-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|