C32H42F5NO3S — CID 56592410
6-(3,5-difluorophenyl)-5-[6-[methyl-[3-(5,5,5-trifluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 56592410) has the molecular formula C32H42F5NO3S and a molecular weight of 615.75 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-5-[6-[methyl-[3-(5,5,5-trifluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(3,5-difluorophenyl)-5-[6-[methyl-[3-(5,5,5-trifluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 56592410 |
| Molecular Formula | C32H42F5NO3S |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | 6-(3,5-difluorophenyl)-5-[6-[methyl-[3-(5,5,5-trifluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CN(CCCCCCC1=C(c2cc(F)cc(F)c2)CCCc2cc(O)ccc21)CCCS(=O)(=O)CCCCC(F)(F)F |
| InChI | InChI=1S/C32H42F5NO3S/c1-38(17-9-19-42(40,41)18-7-5-15-32(35,36)37)16-6-3-2-4-11-31-29(25-20-26(33)23-27(34)21-25)12-8-10-24-22-28(39)13-14-30(24)31/h13-14,20-23,39H,2-12,15-19H2,1H3 |
| InChIKey | WSXSNDZKOCHQFD-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|