C17H23F5O3 — CID 56618937
5-butyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane (PubChem CID 56618937) has the molecular formula C17H23F5O3 and a molecular weight of 370.36 g/mol. Its IUPAC name is 5-butyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane.
| Compound Name | 5-butyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 56618937 |
| Molecular Formula | C17H23F5O3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 5-butyl-2-[4-(1,1,2,2,3-pentafluoropropoxy)cyclohexa-1,5-dien-1-yl]-1,3-dioxane |
| SMILES | CCCCC1COC(C2=CCC(OC(F)(F)C(F)(F)CF)C=C2)OC1 |
| InChI | InChI=1S/C17H23F5O3/c1-2-3-4-12-9-23-15(24-10-12)13-5-7-14(8-6-13)25-17(21,22)16(19,20)11-18/h5-7,12,14-15H,2-4,8-11H2,1H3 |
| InChIKey | PNAHZRSGBYXVPF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|