C40H49F3O5 — CID 56628815
[(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-[4-[(5S)-5-methylheptoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 56628815) has the molecular formula C40H49F3O5 and a molecular weight of 666.82 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-[4-[(5S)-5-methylheptoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-[4-[(5S)-5-methylheptoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56628815 |
| Molecular Formula | C40H49F3O5 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-[4-[(5S)-5-methylheptoxy]phenyl]benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCC[C@@H](OC(=O)C1CCc2ccccc2C1OC(=O)c1ccc(-c2ccc(OCCCC[C@@H](C)CC)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C40H49F3O5/c1-4-6-7-8-16-36(40(41,42)43)47-39(45)35-26-23-31-14-9-10-15-34(31)37(35)48-38(44)32-19-17-29(18-20-32)30-21-24-33(25-22-30)46-27-12-11-13-28(3)5-2/h9-10,14-15,17-22,24-25,28,35-37H,4-8,11-13,16,23,26-27H2,1-3H3/t28-,35?,36+,37?/m0/s1 |
| InChIKey | DVPZYROAEWKSQK-CKOYMSGTSA-N |
| XLogP | 10.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|