C33H35NO4 — CID 56650139
dimethyl 2-ethyl-3,3,5-triphenyl-1-propyl-2H-azepine-6,7-dicarboxylate (PubChem CID 56650139) has the molecular formula C33H35NO4 and a molecular weight of 509.65 g/mol. Its IUPAC name is dimethyl 2-ethyl-3,3,5-triphenyl-1-propyl-2H-azepine-6,7-dicarboxylate.
| Compound Name | dimethyl 2-ethyl-3,3,5-triphenyl-1-propyl-2H-azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650139 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | dimethyl 2-ethyl-3,3,5-triphenyl-1-propyl-2H-azepine-6,7-dicarboxylate |
| SMILES | CCCN1C(C(=O)OC)=C(C(=O)OC)C(c2ccccc2)=CC(c2ccccc2)(c2ccccc2)C1CC |
| InChI | InChI=1S/C33H35NO4/c1-5-22-34-28(6-2)33(25-18-12-8-13-19-25,26-20-14-9-15-21-26)23-27(24-16-10-7-11-17-24)29(31(35)37-3)30(34)32(36)38-4/h7-21,23,28H,5-6,22H2,1-4H3 |
| InChIKey | FJPJYBDTXGGZJB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |