C33H33NO5 — CID 56650473
diethyl 8,10,10-triphenyl-1,3,4,10a-tetrahydro-[1,4]oxazino[4,3-a]azepine-6,7-dicarboxylate (PubChem CID 56650473) has the molecular formula C33H33NO5 and a molecular weight of 523.63 g/mol. Its IUPAC name is diethyl 8,10,10-triphenyl-1,3,4,10a-tetrahydro-[1,4]oxazino[4,3-a]azepine-6,7-dicarboxylate.
| Compound Name | diethyl 8,10,10-triphenyl-1,3,4,10a-tetrahydro-[1,4]oxazino[4,3-a]azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650473 |
| Molecular Formula | C33H33NO5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | diethyl 8,10,10-triphenyl-1,3,4,10a-tetrahydro-[1,4]oxazino[4,3-a]azepine-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N2CCOCC2C(c2ccccc2)(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C33H33NO5/c1-3-38-31(35)29-27(24-14-8-5-9-15-24)22-33(25-16-10-6-11-17-25,26-18-12-7-13-19-26)28-23-37-21-20-34(28)30(29)32(36)39-4-2/h5-19,22,28H,3-4,20-21,23H2,1-2H3 |
| InChIKey | AGCUXINAWXTXJV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |