C37H35NO4 — CID 56650814
dimethyl 2,3,3,5-tetraphenyl-1-propan-2-yl-2H-azepine-6,7-dicarboxylate (PubChem CID 56650814) has the molecular formula C37H35NO4 and a molecular weight of 557.69 g/mol. Its IUPAC name is dimethyl 2,3,3,5-tetraphenyl-1-propan-2-yl-2H-azepine-6,7-dicarboxylate.
| Compound Name | dimethyl 2,3,3,5-tetraphenyl-1-propan-2-yl-2H-azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650814 |
| Molecular Formula | C37H35NO4 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | dimethyl 2,3,3,5-tetraphenyl-1-propan-2-yl-2H-azepine-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(C(C)C)C(c2ccccc2)C(c2ccccc2)(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C37H35NO4/c1-26(2)38-33(36(40)42-4)32(35(39)41-3)31(27-17-9-5-10-18-27)25-37(29-21-13-7-14-22-29,30-23-15-8-16-24-30)34(38)28-19-11-6-12-20-28/h5-26,34H,1-4H3 |
| InChIKey | AZPNMYCWQJLJQB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |