C38H37NO4 — CID 56650475
diethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate (PubChem CID 56650475) has the molecular formula C38H37NO4 and a molecular weight of 571.72 g/mol. Its IUPAC name is diethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate.
| Compound Name | diethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650475 |
| Molecular Formula | C38H37NO4 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | diethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(CC)C(c2ccccc2)C(c2ccccc2)(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C38H37NO4/c1-4-39-34(37(41)43-6-3)33(36(40)42-5-2)32(28-19-11-7-12-20-28)27-38(30-23-15-9-16-24-30,31-25-17-10-18-26-31)35(39)29-21-13-8-14-22-29/h7-27,35H,4-6H2,1-3H3 |
| InChIKey | UXDDCXJWDVOUGC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |