C36H33NO4 — CID 56650474
dimethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate (PubChem CID 56650474) has the molecular formula C36H33NO4 and a molecular weight of 543.66 g/mol. Its IUPAC name is dimethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate.
| Compound Name | dimethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650474 |
| Molecular Formula | C36H33NO4 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | dimethyl 1-ethyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate |
| SMILES | CCN1C(C(=O)OC)=C(C(=O)OC)C(c2ccccc2)=CC(c2ccccc2)(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C36H33NO4/c1-4-37-32(35(39)41-3)31(34(38)40-2)30(26-17-9-5-10-18-26)25-36(28-21-13-7-14-22-28,29-23-15-8-16-24-29)33(37)27-19-11-6-12-20-27/h5-25,33H,4H2,1-3H3 |
| InChIKey | LRJRPGNDBFHSNE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |