C41H35NO4 — CID 56650141
dimethyl 1-benzyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate (PubChem CID 56650141) has the molecular formula C41H35NO4 and a molecular weight of 605.73 g/mol. Its IUPAC name is dimethyl 1-benzyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650141 |
| Molecular Formula | C41H35NO4 |
| Molecular Weight | 605.73 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | dimethyl 1-benzyl-2,3,3,5-tetraphenyl-2H-azepine-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(Cc2ccccc2)C(c2ccccc2)C(c2ccccc2)(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C41H35NO4/c1-45-39(43)36-35(31-20-10-4-11-21-31)28-41(33-24-14-6-15-25-33,34-26-16-7-17-27-34)38(32-22-12-5-13-23-32)42(37(36)40(44)46-2)29-30-18-8-3-9-19-30/h3-28,38H,29H2,1-2H3 |
| InChIKey | JYOIOIJNQQXKBG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.73 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |