C35H39NO4 — CID 56650140
dimethyl 1-butyl-3,3,5-triphenyl-2-propyl-2H-azepine-6,7-dicarboxylate (PubChem CID 56650140) has the molecular formula C35H39NO4 and a molecular weight of 537.70 g/mol. Its IUPAC name is dimethyl 1-butyl-3,3,5-triphenyl-2-propyl-2H-azepine-6,7-dicarboxylate.
| Compound Name | dimethyl 1-butyl-3,3,5-triphenyl-2-propyl-2H-azepine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 56650140 |
| Molecular Formula | C35H39NO4 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | dimethyl 1-butyl-3,3,5-triphenyl-2-propyl-2H-azepine-6,7-dicarboxylate |
| SMILES | CCCCN1C(C(=O)OC)=C(C(=O)OC)C(c2ccccc2)=CC(c2ccccc2)(c2ccccc2)C1CCC |
| InChI | InChI=1S/C35H39NO4/c1-5-7-24-36-30(17-6-2)35(27-20-13-9-14-21-27,28-22-15-10-16-23-28)25-29(26-18-11-8-12-19-26)31(33(37)39-3)32(36)34(38)40-4/h8-16,18-23,25,30H,5-7,17,24H2,1-4H3 |
| InChIKey | KRDRUJNDURZVRL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |