C14H15F2N5O — CID 56700309
1-(2,4-difluorophenyl)-3-[2-[(6-methylpyridazin-3-yl)amino]ethyl]urea (PubChem CID 56700309) has the molecular formula C14H15F2N5O and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-[(6-methylpyridazin-3-yl)amino]ethyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-[(6-methylpyridazin-3-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 56700309 |
| Molecular Formula | C14H15F2N5O |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-[(6-methylpyridazin-3-yl)amino]ethyl]urea |
| SMILES | Cc1ccc(NCCNC(=O)Nc2ccc(F)cc2F)nn1 |
| InChI | InChI=1S/C14H15F2N5O/c1-9-2-5-13(21-20-9)17-6-7-18-14(22)19-12-4-3-10(15)8-11(12)16/h2-5,8H,6-7H2,1H3,(H,17,21)(H2,18,19,22) |
| InChIKey | KUFRRTHYROYLFI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|