About 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid
5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid (PubChem CID 56961792) has the molecular formula C10H9N3O5
and a molecular weight of 251.20 g/mol. Its IUPAC name is 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid |
| PubChem CID | 56961792 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid |
| SMILES | CC(=O)c1oc(C(=O)O)c(Cn2cncn2)c1O |
| InChI | InChI=1S/C10H9N3O5/c1-5(14)8-7(15)6(9(18-8)10(16)17)2-13-4-11-3-12-13/h3-4,15H,2H2,1H3,(H,16,17) |
| InChIKey | DWMCWTLBKWJXON-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid?
The IUPAC name of 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid (CID 56961792) is 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid.
What is the SMILES notation for 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid?
The canonical SMILES for 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid is CC(=O)c1oc(C(=O)O)c(Cn2cncn2)c1O.
What is the InChIKey of 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid?
The InChIKey is DWMCWTLBKWJXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O5/c1-5(14)8-7(15)6(9(18-8)10(16)17)2-13-4-11-3-12-13/h3-4,15H,2H2,1H3,(H,16,17).
What are the key properties of 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid?
5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid has a molecular weight of 251.20 g/mol, XLogP of 0.53, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-4-hydroxy-3-(1,2,4-triazol-1-ylmethyl)furan-2-carboxylic acid is sourced from PubChem (CID 56961792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).