C17H32O6S — CID 56979276
2-[4-[3,5-dihydroxy-2-(2-hydroxyhexylsulfanyl)cyclopentyl]butoxy]acetic acid (PubChem CID 56979276) has the molecular formula C17H32O6S and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-[4-[3,5-dihydroxy-2-(2-hydroxyhexylsulfanyl)cyclopentyl]butoxy]acetic acid.
| Compound Name | 2-[4-[3,5-dihydroxy-2-(2-hydroxyhexylsulfanyl)cyclopentyl]butoxy]acetic acid |
|---|---|
| PubChem CID | 56979276 |
| Molecular Formula | C17H32O6S |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[4-[3,5-dihydroxy-2-(2-hydroxyhexylsulfanyl)cyclopentyl]butoxy]acetic acid |
| SMILES | CCCCC(O)CSC1C(O)CC(O)C1CCCCOCC(=O)O |
| InChI | InChI=1S/C17H32O6S/c1-2-3-6-12(18)11-24-17-13(14(19)9-15(17)20)7-4-5-8-23-10-16(21)22/h12-15,17-20H,2-11H2,1H3,(H,21,22) |
| InChIKey | LXFGFCYTGCRNOY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|