C22H22N4O — CID 56984308
5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine (PubChem CID 56984308) has the molecular formula C22H22N4O and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine.
| Compound Name | 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 56984308 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine |
| SMILES | CCCCOc1[nH]c(N)c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C22H22N4O/c1-2-3-14-27-22-20-19(21(23)26-22)24-17(15-10-6-4-7-11-15)18(25-20)16-12-8-5-9-13-16/h4-13,26H,2-3,14,23H2,1H3 |
| InChIKey | YOMRSLZQVNTFET-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|