About 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine
5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine (PubChem CID 56984308) has the molecular formula C22H22N4O
and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine.
Molecular Properties
| Compound Name | 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine |
| PubChem CID | 56984308 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine |
| SMILES | CCCCOc1[nH]c(N)c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C22H22N4O/c1-2-3-14-27-22-20-19(21(23)26-22)24-17(15-10-6-4-7-11-15)18(25-20)16-12-8-5-9-13-16/h4-13,26H,2-3,14,23H2,1H3 |
| InChIKey | YOMRSLZQVNTFET-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine?
The IUPAC name of 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine (CID 56984308) is 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine.
What is the SMILES notation for 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine?
The canonical SMILES for 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine is CCCCOc1[nH]c(N)c2nc(-c3ccccc3)c(-c3ccccc3)nc12.
What is the InChIKey of 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine?
The InChIKey is YOMRSLZQVNTFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O/c1-2-3-14-27-22-20-19(21(23)26-22)24-17(15-10-6-4-7-11-15)18(25-20)16-12-8-5-9-13-16/h4-13,26H,2-3,14,23H2,1H3.
What are the key properties of 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine?
5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine has a molecular weight of 358.44 g/mol, XLogP of 5.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-2,3-diphenyl-6H-pyrrolo[3,4-b]pyrazin-7-amine is sourced from PubChem (CID 56984308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).