C29H31NO2 — CID 56993277
6,6-dimethyl-3-(2-nitroso-2-trityloxyethyl)bicyclo[3.1.0]hexane (PubChem CID 56993277) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is 6,6-dimethyl-3-(2-nitroso-2-trityloxyethyl)bicyclo[3.1.0]hexane.
| Compound Name | 6,6-dimethyl-3-(2-nitroso-2-trityloxyethyl)bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 56993277 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 6,6-dimethyl-3-(2-nitroso-2-trityloxyethyl)bicyclo[3.1.0]hexane |
| SMILES | CC1(C)C2CC(CC(N=O)OC(c3ccccc3)(c3ccccc3)c3ccccc3)CC21 |
| InChI | InChI=1S/C29H31NO2/c1-28(2)25-18-21(19-26(25)28)20-27(30-31)32-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,21,25-27H,18-20H2,1-2H3 |
| InChIKey | OQZNUTJFZTZHEI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|