C38H38ClNO7 — CID 57031648
bis(1-phenylethyl) 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-1,3-dioxole-2,2-dicarboxylate (PubChem CID 57031648) has the molecular formula C38H38ClNO7 and a molecular weight of 656.18 g/mol. Its IUPAC name is bis(1-phenylethyl) 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-1,3-dioxole-2,2-dicarboxylate.
| Compound Name | bis(1-phenylethyl) 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-1,3-dioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 57031648 |
| Molecular Formula | C38H38ClNO7 |
| Molecular Weight | 656.18 g/mol |
| Exact Mass | 655.23 |
| IUPAC Name | bis(1-phenylethyl) 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-1,3-dioxole-2,2-dicarboxylate |
| SMILES | CC(Cc1cccc(C2=COC(C(=O)OC(C)c3ccccc3)(C(=O)OC(C)c3ccccc3)O2)c1)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C38H38ClNO7/c1-25(40-23-34(41)31-17-11-19-33(39)22-31)20-28-12-10-18-32(21-28)35-24-44-38(47-35,36(42)45-26(2)29-13-6-4-7-14-29)37(43)46-27(3)30-15-8-5-9-16-30/h4-19,21-22,24-27,34,40-41H,20,23H2,1-3H3 |
| InChIKey | LYHHPPVVGIMWNE-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.18 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|