C35H44ClNO7 — CID 67589339
4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-2-(dicyclohexylmethoxycarbonyl)-1,3-dioxole-2-carboxylic acid (PubChem CID 67589339) has the molecular formula C35H44ClNO7 and a molecular weight of 626.19 g/mol. Its IUPAC name is 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-2-(dicyclohexylmethoxycarbonyl)-1,3-dioxole-2-carboxylic acid.
| Compound Name | 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-2-(dicyclohexylmethoxycarbonyl)-1,3-dioxole-2-carboxylic acid |
|---|---|
| PubChem CID | 67589339 |
| Molecular Formula | C35H44ClNO7 |
| Molecular Weight | 626.19 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 4-[3-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]-2-(dicyclohexylmethoxycarbonyl)-1,3-dioxole-2-carboxylic acid |
| SMILES | CC(Cc1cccc(C2=COC(C(=O)O)(C(=O)OC(C3CCCCC3)C3CCCCC3)O2)c1)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C35H44ClNO7/c1-23(37-21-30(38)27-15-9-17-29(36)20-27)18-24-10-8-16-28(19-24)31-22-42-35(44-31,33(39)40)34(41)43-32(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h8-10,15-17,19-20,22-23,25-26,30,32,37-38H,2-7,11-14,18,21H2,1H3,(H,39,40) |
| InChIKey | LAVPPESKAMLGPC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.19 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|