C20H22N4OS — CID 57038523
(2S)-2-[2-(1H-imidazol-5-ylmethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-5-yl]-2-phenylethanol (PubChem CID 57038523) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is (2S)-2-[2-(1H-imidazol-5-ylmethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-5-yl]-2-phenylethanol.
| Compound Name | (2S)-2-[2-(1H-imidazol-5-ylmethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-5-yl]-2-phenylethanol |
|---|---|
| PubChem CID | 57038523 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (2S)-2-[2-(1H-imidazol-5-ylmethyl)-3,4-dihydro-1,2,5-benzothiadiazepin-5-yl]-2-phenylethanol |
| SMILES | OC[C@H](c1ccccc1)N1CCN(Cc2cnc[nH]2)Sc2ccccc21 |
| InChI | InChI=1S/C20H22N4OS/c25-14-19(16-6-2-1-3-7-16)24-11-10-23(13-17-12-21-15-22-17)26-20-9-5-4-8-18(20)24/h1-9,12,15,19,25H,10-11,13-14H2,(H,21,22)/t19-/m1/s1 |
| InChIKey | GFEDPWOMLXVOFO-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|