C14H17F — CID 57039976
14-fluoropentacyclo[8.2.1.15,8.02,6.02,9]tetradec-11-ene (PubChem CID 57039976) has the molecular formula C14H17F and a molecular weight of 204.29 g/mol. Its IUPAC name is 14-fluoropentacyclo[8.2.1.15,8.02,6.02,9]tetradec-11-ene.
| Compound Name | 14-fluoropentacyclo[8.2.1.15,8.02,6.02,9]tetradec-11-ene |
|---|---|
| PubChem CID | 57039976 |
| Molecular Formula | C14H17F |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 14-fluoropentacyclo[8.2.1.15,8.02,6.02,9]tetradec-11-ene |
| SMILES | FC1C2CCC34C5C=CC(C5)C3C1CC24 |
| InChI | InChI=1S/C14H17F/c15-13-9-3-4-14-8-2-1-7(5-8)12(14)10(13)6-11(9)14/h1-2,7-13H,3-6H2 |
| InChIKey | WFKPBEZVDYFICH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|