C27H28O3S — CID 57053288
2-[3-(1-adamantyl)-4-prop-2-enoxybenzoyl]benzenecarbothioic S-acid (PubChem CID 57053288) has the molecular formula C27H28O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-[3-(1-adamantyl)-4-prop-2-enoxybenzoyl]benzenecarbothioic S-acid.
| Compound Name | 2-[3-(1-adamantyl)-4-prop-2-enoxybenzoyl]benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 57053288 |
| Molecular Formula | C27H28O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-[3-(1-adamantyl)-4-prop-2-enoxybenzoyl]benzenecarbothioic S-acid |
| SMILES | C=CCOc1ccc(C(=O)c2ccccc2C(=O)S)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H28O3S/c1-2-9-30-24-8-7-20(25(28)21-5-3-4-6-22(21)26(29)31)13-23(24)27-14-17-10-18(15-27)12-19(11-17)16-27/h2-8,13,17-19H,1,9-12,14-16H2,(H,29,31) |
| InChIKey | AUNILYNLEHQASQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|