C25H29NO4 — CID 57053310
2-ethyl-6-methoxy-9-[3-(4-methylphenyl)propoxy]-4,5-dihydrobenzo[e]isoindole-1,3-diol (PubChem CID 57053310) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-9-[3-(4-methylphenyl)propoxy]-4,5-dihydrobenzo[e]isoindole-1,3-diol.
| Compound Name | 2-ethyl-6-methoxy-9-[3-(4-methylphenyl)propoxy]-4,5-dihydrobenzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 57053310 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-ethyl-6-methoxy-9-[3-(4-methylphenyl)propoxy]-4,5-dihydrobenzo[e]isoindole-1,3-diol |
| SMILES | CCn1c(O)c2c(c1O)-c1c(OCCCc3ccc(C)cc3)ccc(OC)c1CC2 |
| InChI | InChI=1S/C25H29NO4/c1-4-26-24(27)19-12-11-18-20(29-3)13-14-21(22(18)23(19)25(26)28)30-15-5-6-17-9-7-16(2)8-10-17/h7-10,13-14,27-28H,4-6,11-12,15H2,1-3H3 |
| InChIKey | LBLFSLRAJIQIGI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|