C12H16N2O5 — CID 57053391
1-phenyl-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea (PubChem CID 57053391) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-phenyl-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea.
| Compound Name | 1-phenyl-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea |
|---|---|
| PubChem CID | 57053391 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-phenyl-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]urea |
| SMILES | NC(=O)N(c1ccccc1)[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N2O5/c13-12(18)14(7-4-2-1-3-5-7)11-10(17)9(16)8(15)6-19-11/h1-5,8-11,15-17H,6H2,(H2,13,18)/t8-,9+,10-,11-/m1/s1 |
| InChIKey | GPZFMLHWAOXYHM-LMLFDSFASA-N |
| XLogP | -0.99 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |