C19H25NO4 — CID 57067463
[(4aR,5R,6R,7R)-6-hydroxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-7-yl] propanoate (PubChem CID 57067463) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [(4aR,5R,6R,7R)-6-hydroxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-7-yl] propanoate.
| Compound Name | [(4aR,5R,6R,7R)-6-hydroxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-7-yl] propanoate |
|---|---|
| PubChem CID | 57067463 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [(4aR,5R,6R,7R)-6-hydroxy-1,3,4a,5-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f]indol-7-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1C=C2C=C3C(=C(C)C(=O)N3C)C[C@]2(C)[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C19H25NO4/c1-6-16(21)24-15-8-12-7-14-13(10(2)18(23)20(14)5)9-19(12,4)11(3)17(15)22/h7-8,11,15,17,22H,6,9H2,1-5H3/t11-,15+,17+,19+/m0/s1 |
| InChIKey | FPNQWAXWJRDZBG-VCWVEYATSA-N |
| XLogP | 2.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |