C20H31NO4 — CID 159069231
(4aR,5R,6R,7R)-7-ethoxy-6-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one;ethanol (PubChem CID 159069231) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (4aR,5R,6R,7R)-7-ethoxy-6-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one;ethanol.
| Compound Name | (4aR,5R,6R,7R)-7-ethoxy-6-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one;ethanol |
|---|---|
| PubChem CID | 159069231 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (4aR,5R,6R,7R)-7-ethoxy-6-hydroxy-1,3,4a,5-tetramethyl-4,5,6,7-tetrahydrobenzo[f]indol-2-one;ethanol |
| SMILES | CCO.CCO[C@@H]1C=C2C=C3C(=C(C)C(=O)N3C)C[C@]2(C)[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C18H25NO3.C2H6O/c1-6-22-15-8-12-7-14-13(10(2)17(21)19(14)5)9-18(12,4)11(3)16(15)20;1-2-3/h7-8,11,15-16,20H,6,9H2,1-5H3;3H,2H2,1H3/t11-,15+,16+,18+;/m0./s1 |
| InChIKey | JZLARZWCDCDBDH-IKRMLJQTSA-N |
| XLogP | 2.41 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |