C19H24O6 — CID 70239801
[(4aR,5R,6R,7S)-7-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] ethyl carbonate (PubChem CID 70239801) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(4aR,5R,6R,7S)-7-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] ethyl carbonate.
| Compound Name | [(4aR,5R,6R,7S)-7-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70239801 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(4aR,5R,6R,7S)-7-methoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@H]1[C@@H](OC)C=C2C=C3OC(=O)C(C)=C3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C19H24O6/c1-6-23-18(21)25-16-11(3)19(4)9-13-10(2)17(20)24-14(13)7-12(19)8-15(16)22-5/h7-8,11,15-16H,6,9H2,1-5H3/t11-,15-,16+,19+/m0/s1 |
| InChIKey | QAHPYAJZVRWFMJ-MYRBDLLGSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |