C30H22O12 — CID 57068871
5,8,14,20,23,28-hexahydroxy-6,21-dimethyloctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4,6,8,19,21,23-hexaene-3,10,12,18,25,27-hexone (PubChem CID 57068871) has the molecular formula C30H22O12 and a molecular weight of 574.49 g/mol. Its IUPAC name is 5,8,14,20,23,28-hexahydroxy-6,21-dimethyloctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4,6,8,19,21,23-hexaene-3,10,12,18,25,27-hexone.
| Compound Name | 5,8,14,20,23,28-hexahydroxy-6,21-dimethyloctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4,6,8,19,21,23-hexaene-3,10,12,18,25,27-hexone |
|---|---|
| PubChem CID | 57068871 |
| Molecular Formula | C30H22O12 |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 5,8,14,20,23,28-hexahydroxy-6,21-dimethyloctacyclo[14.11.1.02,11.02,15.04,9.013,17.017,26.019,24]octacosa-4,6,8,19,21,23-hexaene-3,10,12,18,25,27-hexone |
| SMILES | Cc1cc(O)c2c(c1O)C(=O)C13C(C2=O)C(=O)C2C(O)C1C1C(O)C3C(=O)C3C(=O)c4c(O)cc(C)c(O)c4C(=O)C321 |
| InChI | InChI=1S/C30H22O12/c1-5-3-7(31)9-11(19(5)33)27(41)29-13-14-24(38)17(29)26(40)16-22(36)10-8(32)4-6(2)20(34)12(10)28(42)30(14,16)18(23(13)37)25(39)15(29)21(9)35/h3-4,13-18,23-24,31-34,37-38H,1-2H3 |
| InChIKey | RMJRHCQQOOJZIG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|