C27H40NO6+ — CID 57082788
[(2R)-2-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]azanium (PubChem CID 57082788) has the molecular formula C27H40NO6+ and a molecular weight of 474.62 g/mol. Its IUPAC name is [(2R)-2-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]azanium.
| Compound Name | [(2R)-2-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]azanium |
|---|---|
| PubChem CID | 57082788 |
| Molecular Formula | C27H40NO6+ |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | [(2R)-2-cyclohexyl-1-oxo-1-phenylmethoxypropan-2-yl]-[(2-methylpropan-2-yl)oxycarbonyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]azanium |
| SMILES | CC(C)(C)OC(=O)C=[N+](C(=O)OC(C)(C)C)[C@@](C)(C(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H40NO6/c1-25(2,3)33-22(29)18-28(24(31)34-26(4,5)6)27(7,21-16-12-9-13-17-21)23(30)32-19-20-14-10-8-11-15-20/h8,10-11,14-15,18,21H,9,12-13,16-17,19H2,1-7H3/q+1/t27-/m1/s1 |
| InChIKey | RPLSFTGETPYBPW-HHHXNRCGSA-N |
| XLogP | 5.43 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|