C19H27N4O4S+ — CID 57096906
2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[1-hydroxy-8-(methanesulfonamido)naphthalen-2-yl]acetamide (PubChem CID 57096906) has the molecular formula C19H27N4O4S+ and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[1-hydroxy-8-(methanesulfonamido)naphthalen-2-yl]acetamide.
| Compound Name | 2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[1-hydroxy-8-(methanesulfonamido)naphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 57096906 |
| Molecular Formula | C19H27N4O4S+ |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(1,4-dimethylpiperazin-1-ium-1-yl)-N-[1-hydroxy-8-(methanesulfonamido)naphthalen-2-yl]acetamide |
| SMILES | CN1CC[N+](C)(CC(=O)Nc2ccc3cccc(NS(C)(=O)=O)c3c2O)CC1 |
| InChI | InChI=1S/C19H26N4O4S/c1-22-9-11-23(2,12-10-22)13-17(24)20-16-8-7-14-5-4-6-15(18(14)19(16)25)21-28(3,26)27/h4-8,21H,9-13H2,1-3H3,(H-,20,24,25)/p+1 |
| InChIKey | WDTUNEPWPOBTKH-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|