C11H21N3 — CID 57105762
2,4-dimethyl-5-(2-methylpropyldiazenyl)pentanenitrile (PubChem CID 57105762) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2,4-dimethyl-5-(2-methylpropyldiazenyl)pentanenitrile.
| Compound Name | 2,4-dimethyl-5-(2-methylpropyldiazenyl)pentanenitrile |
|---|---|
| PubChem CID | 57105762 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 2,4-dimethyl-5-(2-methylpropyldiazenyl)pentanenitrile |
| SMILES | CC(C)C/N=N/CC(C)CC(C)C#N |
| InChI | InChI=1S/C11H21N3/c1-9(2)7-13-14-8-11(4)5-10(3)6-12/h9-11H,5,7-8H2,1-4H3/b14-13+ |
| InChIKey | VUAKAZSZSVZJON-BUHFOSPRSA-N |
| XLogP | 3.28 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|