C31H29N6O3P — CID 57118447
3-[5-[1-(diphenoxyphosphorylmethylamino)-2-(4-phenylphenyl)ethyl]tetrazol-1-yl]propanenitrile (PubChem CID 57118447) has the molecular formula C31H29N6O3P and a molecular weight of 564.59 g/mol. Its IUPAC name is 3-[5-[1-(diphenoxyphosphorylmethylamino)-2-(4-phenylphenyl)ethyl]tetrazol-1-yl]propanenitrile.
| Compound Name | 3-[5-[1-(diphenoxyphosphorylmethylamino)-2-(4-phenylphenyl)ethyl]tetrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 57118447 |
| Molecular Formula | C31H29N6O3P |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 3-[5-[1-(diphenoxyphosphorylmethylamino)-2-(4-phenylphenyl)ethyl]tetrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1nnnc1C(Cc1ccc(-c2ccccc2)cc1)NCP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C31H29N6O3P/c32-21-10-22-37-31(34-35-36-37)30(23-25-17-19-27(20-18-25)26-11-4-1-5-12-26)33-24-41(38,39-28-13-6-2-7-14-28)40-29-15-8-3-9-16-29/h1-9,11-20,30,33H,10,22-24H2 |
| InChIKey | HNJIBAMACUPHJX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|