C17H24ClN3O4S — CID 57152335
4-[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]thiomorpholin-4-yl]butanoic acid (PubChem CID 57152335) has the molecular formula C17H24ClN3O4S and a molecular weight of 401.92 g/mol. Its IUPAC name is 4-[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]thiomorpholin-4-yl]butanoic acid.
| Compound Name | 4-[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]thiomorpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 57152335 |
| Molecular Formula | C17H24ClN3O4S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]thiomorpholin-4-yl]butanoic acid |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CN(CCCC(=O)O)CCS1 |
| InChI | InChI=1S/C17H24ClN3O4S/c1-25-15-8-14(19)13(18)7-12(15)17(24)20-9-11-10-21(5-6-26-11)4-2-3-16(22)23/h7-8,11H,2-6,9-10,19H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | LINNVLMBRJRHMQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|