C13H11FN4O6S2 — CID 57171063
4-(1-amino-4-fluoro-2H-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid (PubChem CID 57171063) has the molecular formula C13H11FN4O6S2 and a molecular weight of 402.39 g/mol. Its IUPAC name is 4-(1-amino-4-fluoro-2H-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid.
| Compound Name | 4-(1-amino-4-fluoro-2H-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 57171063 |
| Molecular Formula | C13H11FN4O6S2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 4-(1-amino-4-fluoro-2H-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid |
| SMILES | NN1C=NC(F)=NC1c1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C13H11FN4O6S2/c14-13-16-6-18(15)12(17-13)11-5-9(26(22,23)24)4-7-3-8(25(19,20)21)1-2-10(7)11/h1-6,12H,15H2,(H,19,20,21)(H,22,23,24) |
| InChIKey | YSUDTPVHAITCIZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|