C22H35NO2 — CID 57173771
1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-5-methylhexan-1-one (PubChem CID 57173771) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-5-methylhexan-1-one.
| Compound Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-5-methylhexan-1-one |
|---|---|
| PubChem CID | 57173771 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-5-methylhexan-1-one |
| SMILES | CC(C)CCCC(=O)C1CC(c2ccc(CN(C)C)cc2)CCC1O |
| InChI | InChI=1S/C22H35NO2/c1-16(2)6-5-7-21(24)20-14-19(12-13-22(20)25)18-10-8-17(9-11-18)15-23(3)4/h8-11,16,19-20,22,25H,5-7,12-15H2,1-4H3 |
| InChIKey | GMBDOORCSRSKHF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |