C13H20N5O5P — CID 57187218
[[3-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]-hydroxymethyl]-ethoxyphosphinic acid (PubChem CID 57187218) has the molecular formula C13H20N5O5P and a molecular weight of 357.31 g/mol. Its IUPAC name is [[3-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]-hydroxymethyl]-ethoxyphosphinic acid.
| Compound Name | [[3-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]-hydroxymethyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 57187218 |
| Molecular Formula | C13H20N5O5P |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [[3-(6-aminopurin-9-yl)-2-(hydroxymethyl)cyclobutyl]-hydroxymethyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(O)C1CC(n2cnc3c(N)ncnc32)C1CO |
| InChI | InChI=1S/C13H20N5O5P/c1-2-23-24(21,22)13(20)7-3-9(8(7)4-19)18-6-17-10-11(14)15-5-16-12(10)18/h5-9,13,19-20H,2-4H2,1H3,(H,21,22)(H2,14,15,16) |
| InChIKey | VZVNWSSLFNXIND-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|