C15H17N5O8S2 — CID 57219880
[4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-methylsulfanyl-3-oxo-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate (PubChem CID 57219880) has the molecular formula C15H17N5O8S2 and a molecular weight of 459.46 g/mol. Its IUPAC name is [4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-methylsulfanyl-3-oxo-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate.
| Compound Name | [4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-methylsulfanyl-3-oxo-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 57219880 |
| Molecular Formula | C15H17N5O8S2 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | [4-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-4-methylsulfanyl-3-oxo-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate |
| SMILES | CON=C(C(=O)NC1(SC)CON(OC(=O)C2CCC(=O)O2)C1=O)c1csc(N)n1 |
| InChI | InChI=1S/C15H17N5O8S2/c1-25-19-10(7-5-30-14(16)17-7)11(22)18-15(29-2)6-26-20(13(15)24)28-12(23)8-3-4-9(21)27-8/h5,8H,3-4,6H2,1-2H3,(H2,16,17)(H,18,22) |
| InChIKey | WDAXVAXCPARBLH-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|