C24H40O4 — CID 57228956
cis-(1R,2R)-2-[4-[(1R,2R,5R)-2-[3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-hydroxycyclopentyl]butyl]cyclopropane-1-carboxylic acid (PubChem CID 57228956) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is cis-(1R,2R)-2-[4-[(1R,2R,5R)-2-[3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-hydroxycyclopentyl]butyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-2-[4-[(1R,2R,5R)-2-[3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-hydroxycyclopentyl]butyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57228956 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | cis-(1R,2R)-2-[4-[(1R,2R,5R)-2-[3-(1-butylcyclobutyl)-3-hydroxyprop-1-enyl]-5-hydroxycyclopentyl]butyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCC1(C(O)C=C[C@H]2CC[C@@H](O)[C@@H]2CCCC[C@@H]2C[C@H]2C(=O)O)CCC1 |
| InChI | InChI=1S/C24H40O4/c1-2-3-13-24(14-6-15-24)22(26)12-10-17-9-11-21(25)19(17)8-5-4-7-18-16-20(18)23(27)28/h10,12,17-22,25-26H,2-9,11,13-16H2,1H3,(H,27,28)/t17-,18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | CSDZWFCWHZDUKD-CGFCOLRFSA-N |
| XLogP | 4.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|