C16H12N4O5 — CID 57265592
2-(3,3,5-triisocyanatopentyl)isoindole-1,3-dione (PubChem CID 57265592) has the molecular formula C16H12N4O5 and a molecular weight of 340.30 g/mol. Its IUPAC name is 2-(3,3,5-triisocyanatopentyl)isoindole-1,3-dione.
| Compound Name | 2-(3,3,5-triisocyanatopentyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 57265592 |
| Molecular Formula | C16H12N4O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(3,3,5-triisocyanatopentyl)isoindole-1,3-dione |
| SMILES | O=C=NCCC(CCN1C(=O)c2ccccc2C1=O)(N=C=O)N=C=O |
| InChI | InChI=1S/C16H12N4O5/c21-9-17-7-5-16(18-10-22,19-11-23)6-8-20-14(24)12-3-1-2-4-13(12)15(20)25/h1-4H,5-8H2 |
| InChIKey | PCYPILJNYWBYBP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 125.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|