C21H22N4O8S2 — CID 57265957
2-[(3S,5S)-5-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)carbamoyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]ethanethioic S-acid (PubChem CID 57265957) has the molecular formula C21H22N4O8S2 and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-[(3S,5S)-5-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)carbamoyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]ethanethioic S-acid.
| Compound Name | 2-[(3S,5S)-5-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)carbamoyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]ethanethioic S-acid |
|---|---|
| PubChem CID | 57265957 |
| Molecular Formula | C21H22N4O8S2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 2-[(3S,5S)-5-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)carbamoyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]ethanethioic S-acid |
| SMILES | CCOC(=O)c1csc(NC(=O)[C@@H]2C[C@@H](CC(=O)S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H22N4O8S2/c1-2-32-19(28)15-11-35-20(22-15)23-18(27)16-7-13(8-17(26)34)9-24(16)21(29)33-10-12-3-5-14(6-4-12)25(30)31/h3-6,11,13,16H,2,7-10H2,1H3,(H,26,34)(H,22,23,27)/t13-,16-/m0/s1 |
| InChIKey | YOWRDBVQDFTNEJ-BBRMVZONSA-N |
| XLogP | 3.04 |
| TPSA | 158.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|