C26H25N3O8S — CID 10951639
ethyl 2-[[(2S,4R)-4-benzoyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 10951639) has the molecular formula C26H25N3O8S and a molecular weight of 539.57 g/mol. Its IUPAC name is ethyl 2-[[(2S,4R)-4-benzoyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(2S,4R)-4-benzoyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 10951639 |
| Molecular Formula | C26H25N3O8S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | ethyl 2-[[(2S,4R)-4-benzoyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C[C@@H]2C[C@@H](OC(=O)c3ccccc3)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C26H25N3O8S/c1-2-35-25(31)22-16-38-23(27-22)13-20-12-21(37-24(30)18-6-4-3-5-7-18)14-28(20)26(32)36-15-17-8-10-19(11-9-17)29(33)34/h3-11,16,20-21H,2,12-15H2,1H3/t20-,21+/m0/s1 |
| InChIKey | VAEIEGXOQXXAIV-LEWJYISDSA-N |
| XLogP | 4.41 |
| TPSA | 138.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|