C29H23N3O9 — CID 18641473
(4-nitrophenyl)methyl (2S,4R)-4-benzoyloxy-2-[2-(1,3-dioxoisoindol-4-yl)-2-oxoethyl]pyrrolidine-1-carboxylate (PubChem CID 18641473) has the molecular formula C29H23N3O9 and a molecular weight of 557.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-benzoyloxy-2-[2-(1,3-dioxoisoindol-4-yl)-2-oxoethyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-benzoyloxy-2-[2-(1,3-dioxoisoindol-4-yl)-2-oxoethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18641473 |
| Molecular Formula | C29H23N3O9 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-benzoyloxy-2-[2-(1,3-dioxoisoindol-4-yl)-2-oxoethyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(O[C@@H]1C[C@@H](CC(=O)c2cccc3c2C(=O)NC3=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C29H23N3O9/c33-24(22-7-4-8-23-25(22)27(35)30-26(23)34)14-20-13-21(41-28(36)18-5-2-1-3-6-18)15-31(20)29(37)40-16-17-9-11-19(12-10-17)32(38)39/h1-12,20-21H,13-16H2,(H,30,34,35)/t20-,21+/m0/s1 |
| InChIKey | MRWCVPWZBSMGOB-LEWJYISDSA-N |
| XLogP | 3.69 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|