C8H10N2O3 — CID 57270874
2-(2,4-dihydroxyphenyl)-N'-hydroxyethanimidamide (PubChem CID 57270874) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(2,4-dihydroxyphenyl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(2,4-dihydroxyphenyl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 57270874 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-N'-hydroxyethanimidamide |
| SMILES | NC(Cc1ccc(O)cc1O)=NO |
| InChI | InChI=1S/C8H10N2O3/c9-8(10-13)3-5-1-2-6(11)4-7(5)12/h1-2,4,11-13H,3H2,(H2,9,10) |
| InChIKey | UOJWACWZJJUDSA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|