C46H51FN2O3 — CID 57276748
10-[1-[(4-aminophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-(4-fluorophenyl)-7,7-diphenyldecan-3-one (PubChem CID 57276748) has the molecular formula C46H51FN2O3 and a molecular weight of 698.92 g/mol. Its IUPAC name is 10-[1-[(4-aminophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-(4-fluorophenyl)-7,7-diphenyldecan-3-one.
| Compound Name | 10-[1-[(4-aminophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-(4-fluorophenyl)-7,7-diphenyldecan-3-one |
|---|---|
| PubChem CID | 57276748 |
| Molecular Formula | C46H51FN2O3 |
| Molecular Weight | 698.92 g/mol |
| Exact Mass | 698.39 |
| IUPAC Name | 10-[1-[(4-aminophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-(4-fluorophenyl)-7,7-diphenyldecan-3-one |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(N)cc1)N(CCCC(CCCC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C46H51FN2O3/c1-51-44-32-36-26-30-49(43(42(36)33-45(44)52-2)31-35-18-23-40(48)24-19-35)29-10-28-46(37-11-5-3-6-12-37,38-13-7-4-8-14-38)27-9-15-41(50)25-20-34-16-21-39(47)22-17-34/h3-8,11-14,16-19,21-24,32-33,43H,9-10,15,20,25-31,48H2,1-2H3 |
| InChIKey | ZDWHZUKIYFCIOX-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.92 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|