C47H62FN3O3 — CID 57008639
N-[7-[6,7-dimethoxy-1-[5-(propan-2-ylamino)pentyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide (PubChem CID 57008639) has the molecular formula C47H62FN3O3 and a molecular weight of 736.03 g/mol. Its IUPAC name is N-[7-[6,7-dimethoxy-1-[5-(propan-2-ylamino)pentyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[7-[6,7-dimethoxy-1-[5-(propan-2-ylamino)pentyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 57008639 |
| Molecular Formula | C47H62FN3O3 |
| Molecular Weight | 736.03 g/mol |
| Exact Mass | 735.48 |
| IUPAC Name | N-[7-[6,7-dimethoxy-1-[5-(propan-2-ylamino)pentyl]-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
| SMILES | COc1cc2c(cc1OC)C(CCCCCNC(C)C)N(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C47H62FN3O3/c1-36(2)49-30-13-7-12-20-43-42-35-45(54-4)44(53-3)34-38(42)27-33-51(43)32-15-29-47(39-16-8-5-9-17-39,40-18-10-6-11-19-40)28-14-31-50-46(52)26-23-37-21-24-41(48)25-22-37/h5-6,8-11,16-19,21-22,24-25,34-36,43,49H,7,12-15,20,23,26-33H2,1-4H3,(H,50,52) |
| InChIKey | DZQGFLUVPWAALS-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.03 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|