C47H60FN3O3 — CID 70208011
N-[7-[1-[4-(cyclobutylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide (PubChem CID 70208011) has the molecular formula C47H60FN3O3 and a molecular weight of 734.01 g/mol. Its IUPAC name is N-[7-[1-[4-(cyclobutylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[7-[1-[4-(cyclobutylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 70208011 |
| Molecular Formula | C47H60FN3O3 |
| Molecular Weight | 734.01 g/mol |
| Exact Mass | 733.46 |
| IUPAC Name | N-[7-[1-[4-(cyclobutylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
| SMILES | COc1cc2c(cc1OC)C(CCCCNC1CCC1)(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)NCC2 |
| InChI | InChI=1S/C47H60FN3O3/c1-53-43-34-37-26-33-51-47(42(37)35-44(43)54-2,29-9-10-31-49-41-18-11-19-41)30-12-27-46(38-14-5-3-6-15-38,39-16-7-4-8-17-39)28-13-32-50-45(52)25-22-36-20-23-40(48)24-21-36/h3-8,14-17,20-21,23-24,34-35,41,49,51H,9-13,18-19,22,25-33H2,1-2H3,(H,50,52) |
| InChIKey | BHQSYURIOGAYKC-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.01 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|